About 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide
3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide (PubChem CID 19099688) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide |
| PubChem CID | 19099688 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide |
| SMILES | CN(C)C(=O)n1cnc(C(C)(C)C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-9(2,3)7-10-6-13(11-7)8(14)12(4)5/h6H,1-5H3 |
| InChIKey | DGSOKJQVOPLKOR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide?
The IUPAC name of 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide (CID 19099688) is 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide is CN(C)C(=O)n1cnc(C(C)(C)C)n1.
What is the InChIKey of 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide?
The InChIKey is DGSOKJQVOPLKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-9(2,3)7-10-6-13(11-7)8(14)12(4)5/h6H,1-5H3.
What are the key properties of 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide?
3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide has a molecular weight of 196.25 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N,N-dimethyl-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 19099688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).