C6H5F3N2O2 — CID 19099900
5-(1,2,2-trifluoroethyl)-1H-pyrimidine-2,4-dione (PubChem CID 19099900) has the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. Its IUPAC name is 5-(1,2,2-trifluoroethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(1,2,2-trifluoroethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19099900 |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 5-(1,2,2-trifluoroethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(F)C(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H5F3N2O2/c7-3(4(8)9)2-1-10-6(13)11-5(2)12/h1,3-4H,(H2,10,11,12,13) |
| InChIKey | OAQOEWKAMGTKNX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |