C37H74N2O5 — CID 19099907
1,3-bis[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxy]propan-2-ol (PubChem CID 19099907) has the molecular formula C37H74N2O5 and a molecular weight of 627.01 g/mol. Its IUPAC name is 1,3-bis[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxy]propan-2-ol.
| Compound Name | 1,3-bis[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 19099907 |
| Molecular Formula | C37H74N2O5 |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 626.56 |
| IUPAC Name | 1,3-bis[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxy]propan-2-ol |
| SMILES | CCCCCCCCON1C(C)(C)CC(OCC(O)COC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C37H74N2O5/c1-11-13-15-17-19-21-23-43-38-34(3,4)25-32(26-35(38,5)6)41-29-31(40)30-42-33-27-36(7,8)39(37(9,10)28-33)44-24-22-20-18-16-14-12-2/h31-33,40H,11-30H2,1-10H3 |
| InChIKey | RFOVWMNKTOZJJT-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|