About bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate
bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate (PubChem CID 19099948) has the molecular formula C32H32N2O8S2
and a molecular weight of 636.75 g/mol. Its IUPAC name is bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate.
Molecular Properties
| Compound Name | bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate |
| PubChem CID | 19099948 |
| Molecular Formula | C32H32N2O8S2 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate |
| SMILES | Cc1cc(/C=C/c2ccccc2)n(OS(=O)(=O)CCCCS(=O)(=O)On2c(/C=C/c3ccccc3)cc(C)cc2=O)c(=O)c1 |
| InChI | InChI=1S/C32H32N2O8S2/c1-25-21-29(17-15-27-11-5-3-6-12-27)33(31(35)23-25)41-43(37,38)19-9-10-20-44(39,40)42-34-30(22-26(2)24-32(34)36)18-16-28-13-7-4-8-14-28/h3-8,11-18,21-24H,9-10,19-20H2,1-2H3/b17-15+,18-16+ |
| InChIKey | ZUSIPSUWXZXOOS-YTEMWHBBSA-N |
| XLogP | 3.96 |
| TPSA | 130.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate?
The IUPAC name of bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate (CID 19099948) is bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate.
What is the SMILES notation for bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate?
The canonical SMILES for bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate is Cc1cc(/C=C/c2ccccc2)n(OS(=O)(=O)CCCCS(=O)(=O)On2c(/C=C/c3ccccc3)cc(C)cc2=O)c(=O)c1.
What is the InChIKey of bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate?
The InChIKey is ZUSIPSUWXZXOOS-YTEMWHBBSA-N. The full InChI is InChI=1S/C32H32N2O8S2/c1-25-21-29(17-15-27-11-5-3-6-12-27)33(31(35)23-25)41-43(37,38)19-9-10-20-44(39,40)42-34-30(22-26(2)24-32(34)36)18-16-28-13-7-4-8-14-28/h3-8,11-18,21-24H,9-10,19-20H2,1-2H3/b17-15+,18-16+.
What are the key properties of bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate?
bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate has a molecular weight of 636.75 g/mol, XLogP of 3.96, 13 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-methyl-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl] butane-1,4-disulfonate is sourced from PubChem (CID 19099948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).