About [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate
[3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate (PubChem CID 19100363) has the molecular formula C26H32FNO2S
and a molecular weight of 441.61 g/mol. Its IUPAC name is [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate |
| PubChem CID | 19100363 |
| Molecular Formula | C26H32FNO2S |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1ccc(-c2nc3ccc(CCCCCC)cc3s2)c(F)c1 |
| InChI | InChI=1S/C26H32FNO2S/c1-3-5-7-9-11-19-13-16-23-24(17-19)31-26(28-23)21-15-14-20(18-22(21)27)30-25(29)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | ZRKQGJANCLSHRD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate?
The IUPAC name of [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate (CID 19100363) is [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate.
What is the SMILES notation for [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate?
The canonical SMILES for [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate is CCCCCCC(=O)Oc1ccc(-c2nc3ccc(CCCCCC)cc3s2)c(F)c1.
What is the InChIKey of [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate?
The InChIKey is ZRKQGJANCLSHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32FNO2S/c1-3-5-7-9-11-19-13-16-23-24(17-19)31-26(28-23)21-15-14-20(18-22(21)27)30-25(29)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3.
What are the key properties of [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate?
[3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate has a molecular weight of 441.61 g/mol, XLogP of 8.10, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(6-hexyl-1,3-benzothiazol-2-yl)phenyl] heptanoate is sourced from PubChem (CID 19100363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).