C6H6Cl2N2O — CID 19100541
2,5-dichloro-4-methoxy-6-methylpyrimidine (PubChem CID 19100541) has the molecular formula C6H6Cl2N2O and a molecular weight of 193.03 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxy-6-methylpyrimidine.
| Compound Name | 2,5-dichloro-4-methoxy-6-methylpyrimidine |
|---|---|
| PubChem CID | 19100541 |
| Molecular Formula | C6H6Cl2N2O |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | 2,5-dichloro-4-methoxy-6-methylpyrimidine |
| SMILES | COc1nc(Cl)nc(C)c1Cl |
| InChI | InChI=1S/C6H6Cl2N2O/c1-3-4(7)5(11-2)10-6(8)9-3/h1-2H3 |
| InChIKey | JFMBGOKOOURJST-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |