2-methyl-1,3-oxazole-4,5-dicarboxylic acid

C6H5NO5 — CID 19100564

IUPAC2-methyl-1,3-oxazole-4,5-dicarboxylic acid
SMILESCc1nc(C(=O)O)c(C(=O)O)o1
InChIInChI=1S/C6H5NO5/c1-2-7-3(5(8)9)4(12-2)6(10)11/h1H3,(H,8,9)(H,10,11)
InChIKeyOIYQJZAGTOCYLA-UHFFFAOYSA-N
MW171.11 g/mol
LogP0.38
Rot. Bonds2

About 2-methyl-1,3-oxazole-4,5-dicarboxylic acid

2-methyl-1,3-oxazole-4,5-dicarboxylic acid (PubChem CID 19100564) has the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. Its IUPAC name is 2-methyl-1,3-oxazole-4,5-dicarboxylic acid.

Molecular Properties

Compound Name2-methyl-1,3-oxazole-4,5-dicarboxylic acid
PubChem CID19100564
Molecular FormulaC6H5NO5
Molecular Weight171.11 g/mol
Exact Mass171.02
IUPAC Name2-methyl-1,3-oxazole-4,5-dicarboxylic acid
SMILESCc1nc(C(=O)O)c(C(=O)O)o1
InChIInChI=1S/C6H5NO5/c1-2-7-3(5(8)9)4(12-2)6(10)11/h1H3,(H,8,9)(H,10,11)
InChIKeyOIYQJZAGTOCYLA-UHFFFAOYSA-N
XLogP0.38
TPSA100.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.11
LogP ≤ 50.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-methyl-1,3-oxazole-4,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1,3-oxazole-4,5-dicarboxylic acid?
The IUPAC name of 2-methyl-1,3-oxazole-4,5-dicarboxylic acid (CID 19100564) is 2-methyl-1,3-oxazole-4,5-dicarboxylic acid.
What is the SMILES notation for 2-methyl-1,3-oxazole-4,5-dicarboxylic acid?
The canonical SMILES for 2-methyl-1,3-oxazole-4,5-dicarboxylic acid is Cc1nc(C(=O)O)c(C(=O)O)o1.
What is the InChIKey of 2-methyl-1,3-oxazole-4,5-dicarboxylic acid?
The InChIKey is OIYQJZAGTOCYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO5/c1-2-7-3(5(8)9)4(12-2)6(10)11/h1H3,(H,8,9)(H,10,11).
What are the key properties of 2-methyl-1,3-oxazole-4,5-dicarboxylic acid?
2-methyl-1,3-oxazole-4,5-dicarboxylic acid has a molecular weight of 171.11 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-oxazole-4,5-dicarboxylic acid is sourced from PubChem (CID 19100564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).