C12H14N2O2S — CID 19100721
7-cyclohexyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione (PubChem CID 19100721) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 7-cyclohexyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-cyclohexyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 19100721 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 7-cyclohexyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2scc(C3CCCCC3)c2[nH]c1=O |
| InChI | InChI=1S/C12H14N2O2S/c15-10-11(16)14-12-9(13-10)8(6-17-12)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,15)(H,14,16) |
| InChIKey | CMJQTESMKOUKPD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|