C6H2Cl2N2O2S — CID 19100739
6,7-dichloro-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione (PubChem CID 19100739) has the molecular formula C6H2Cl2N2O2S and a molecular weight of 237.07 g/mol. Its IUPAC name is 6,7-dichloro-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6,7-dichloro-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 19100739 |
| Molecular Formula | C6H2Cl2N2O2S |
| Molecular Weight | 237.07 g/mol |
| Exact Mass | 235.92 |
| IUPAC Name | 6,7-dichloro-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2sc(Cl)c(Cl)c2[nH]c1=O |
| InChI | InChI=1S/C6H2Cl2N2O2S/c7-1-2-6(13-3(1)8)10-5(12)4(11)9-2/h(H,9,11)(H,10,12) |
| InChIKey | GDHQKYGLONSKSZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|