C12H8N2O2S — CID 19100767
7-phenyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione (PubChem CID 19100767) has the molecular formula C12H8N2O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is 7-phenyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-phenyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 19100767 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-phenyl-1,4-dihydrothieno[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2scc(-c3ccccc3)c2[nH]c1=O |
| InChI | InChI=1S/C12H8N2O2S/c15-10-11(16)14-12-9(13-10)8(6-17-12)7-4-2-1-3-5-7/h1-6H,(H,13,15)(H,14,16) |
| InChIKey | DNOBRGIQCFHKDP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|