About (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane
(2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane (PubChem CID 19100842) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane.
Molecular Properties
| Compound Name | (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane |
| PubChem CID | 19100842 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane |
| SMILES | CN1CCCN/C1=C/[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N3O2/c1-8-4-2-3-7-6(8)5-9(10)11/h5,7H,2-4H2,1H3/b6-5- |
| InChIKey | ZSQOWZCJWILHLO-WAYWQWQTSA-N |
| XLogP | -0.01 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane?
The IUPAC name of (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane (CID 19100842) is (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane.
What is the SMILES notation for (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane?
The canonical SMILES for (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane is CN1CCCN/C1=C/[N+](=O)[O-].
What is the InChIKey of (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane?
The InChIKey is ZSQOWZCJWILHLO-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-8-4-2-3-7-6(8)5-9(10)11/h5,7H,2-4H2,1H3/b6-5-.
What are the key properties of (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane?
(2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane has a molecular weight of 157.17 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-methyl-2-(nitromethylidene)-1,3-diazinane is sourced from PubChem (CID 19100842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).