About 3H-imidazo[1,2-a]pyrimidin-5-one
3H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 19100927) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 3H-imidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3H-imidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 19100927 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 3H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | O=c1ccnc2n1CC=N2 |
| InChI | InChI=1S/C6H5N3O/c10-5-1-2-7-6-8-3-4-9(5)6/h1-3H,4H2 |
| InChIKey | SLUYEZHWAHGANQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3H-imidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 3H-imidazo[1,2-a]pyrimidin-5-one (CID 19100927) is 3H-imidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 3H-imidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 3H-imidazo[1,2-a]pyrimidin-5-one is O=c1ccnc2n1CC=N2.
What is the InChIKey of 3H-imidazo[1,2-a]pyrimidin-5-one?
The InChIKey is SLUYEZHWAHGANQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-5-1-2-7-6-8-3-4-9(5)6/h1-3H,4H2.
What are the key properties of 3H-imidazo[1,2-a]pyrimidin-5-one?
3H-imidazo[1,2-a]pyrimidin-5-one has a molecular weight of 135.13 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 19100927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).