C10H17BrN2O2 — CID 19100940
ethyl 3a-bromo-1-methyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 19100940) has the molecular formula C10H17BrN2O2 and a molecular weight of 277.16 g/mol. Its IUPAC name is ethyl 3a-bromo-1-methyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | ethyl 3a-bromo-1-methyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 19100940 |
| Molecular Formula | C10H17BrN2O2 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | ethyl 3a-bromo-1-methyl-3,4,6,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)N1CC2N(C)CCC2(Br)C1 |
| InChI | InChI=1S/C10H17BrN2O2/c1-3-15-9(14)13-6-8-10(11,7-13)4-5-12(8)2/h8H,3-7H2,1-2H3 |
| InChIKey | XMGUNNIIFNBGQZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|