C7H13BrN2 — CID 19100965
3a-bromo-1-methyl-2,3,4,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 19100965) has the molecular formula C7H13BrN2 and a molecular weight of 205.10 g/mol. Its IUPAC name is 3a-bromo-1-methyl-2,3,4,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 3a-bromo-1-methyl-2,3,4,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 19100965 |
| Molecular Formula | C7H13BrN2 |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 3a-bromo-1-methyl-2,3,4,5,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CN1CCC2(Br)CNCC12 |
| InChI | InChI=1S/C7H13BrN2/c1-10-3-2-7(8)5-9-4-6(7)10/h6,9H,2-5H2,1H3 |
| InChIKey | YAMZJRDLMNAVOT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|