About 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate
7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate (PubChem CID 19101560) has the molecular formula C15H15F3N4O3
and a molecular weight of 356.30 g/mol. Its IUPAC name is 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate.
Molecular Properties
| Compound Name | 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate |
| PubChem CID | 19101560 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate |
| SMILES | CCCn1c(=O)c(=O)[nH]c2cc(-n3ccnc3)c(C(F)(F)F)cc21.O |
| InChI | InChI=1S/C15H13F3N4O2.H2O/c1-2-4-22-12-6-9(15(16,17)18)11(21-5-3-19-8-21)7-10(12)20-13(23)14(22)24;/h3,5-8H,2,4H2,1H3,(H,20,23);1H2 |
| InChIKey | LFMYNOLXUJSJAA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate?
The IUPAC name of 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate (CID 19101560) is 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate.
What is the SMILES notation for 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate?
The canonical SMILES for 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate is CCCn1c(=O)c(=O)[nH]c2cc(-n3ccnc3)c(C(F)(F)F)cc21.O.
What is the InChIKey of 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate?
The InChIKey is LFMYNOLXUJSJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N4O2.H2O/c1-2-4-22-12-6-9(15(16,17)18)11(21-5-3-19-8-21)7-10(12)20-13(23)14(22)24;/h3,5-8H,2,4H2,1H3,(H,20,23);1H2.
What are the key properties of 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate?
7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate has a molecular weight of 356.30 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-imidazol-1-yl-4-propyl-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione;hydrate is sourced from PubChem (CID 19101560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).