C17H28 — CID 19102351
2-(2-bicyclo[2.2.1]heptanylmethyl)-1-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 19102351) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-1-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 19102351 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CC1C(CC2CC3CCC2C3)CC2CCCC21 |
| InChI | InChI=1S/C17H28/c1-11-15(9-14-3-2-4-17(11)14)10-16-8-12-5-6-13(16)7-12/h11-17H,2-10H2,1H3 |
| InChIKey | BUIHUZVBRWSBOC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |