About 8-ethylbenzo[g][1,3]benzothiazole
8-ethylbenzo[g][1,3]benzothiazole (PubChem CID 19102479) has the molecular formula C13H11NS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 8-ethylbenzo[g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 8-ethylbenzo[g][1,3]benzothiazole |
| PubChem CID | 19102479 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 8-ethylbenzo[g][1,3]benzothiazole |
| SMILES | CCc1ccc2ccc3ncsc3c2c1 |
| InChI | InChI=1S/C13H11NS/c1-2-9-3-4-10-5-6-12-13(11(10)7-9)15-8-14-12/h3-8H,2H2,1H3 |
| InChIKey | MZJCKHVPGDOLMK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethylbenzo[g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethylbenzo[g][1,3]benzothiazole?
The IUPAC name of 8-ethylbenzo[g][1,3]benzothiazole (CID 19102479) is 8-ethylbenzo[g][1,3]benzothiazole.
What is the SMILES notation for 8-ethylbenzo[g][1,3]benzothiazole?
The canonical SMILES for 8-ethylbenzo[g][1,3]benzothiazole is CCc1ccc2ccc3ncsc3c2c1.
What is the InChIKey of 8-ethylbenzo[g][1,3]benzothiazole?
The InChIKey is MZJCKHVPGDOLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NS/c1-2-9-3-4-10-5-6-12-13(11(10)7-9)15-8-14-12/h3-8H,2H2,1H3.
What are the key properties of 8-ethylbenzo[g][1,3]benzothiazole?
8-ethylbenzo[g][1,3]benzothiazole has a molecular weight of 213.31 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethylbenzo[g][1,3]benzothiazole is sourced from PubChem (CID 19102479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).