About 1H-pyrrolo[3,4-d]pyrazole-4,6-dione
1H-pyrrolo[3,4-d]pyrazole-4,6-dione (PubChem CID 19102688) has the molecular formula C5H3N3O2
and a molecular weight of 137.10 g/mol. Its IUPAC name is 1H-pyrrolo[3,4-d]pyrazole-4,6-dione.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,4-d]pyrazole-4,6-dione |
| PubChem CID | 19102688 |
| Molecular Formula | C5H3N3O2 |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | 1H-pyrrolo[3,4-d]pyrazole-4,6-dione |
| SMILES | O=C1NC(=O)c2[nH]ncc21 |
| InChI | InChI=1S/C5H3N3O2/c9-4-2-1-6-8-3(2)5(10)7-4/h1H,(H,6,8)(H,7,9,10) |
| InChIKey | CPPSELCSKOZONN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[3,4-d]pyrazole-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,4-d]pyrazole-4,6-dione?
The IUPAC name of 1H-pyrrolo[3,4-d]pyrazole-4,6-dione (CID 19102688) is 1H-pyrrolo[3,4-d]pyrazole-4,6-dione.
What is the SMILES notation for 1H-pyrrolo[3,4-d]pyrazole-4,6-dione?
The canonical SMILES for 1H-pyrrolo[3,4-d]pyrazole-4,6-dione is O=C1NC(=O)c2[nH]ncc21.
What is the InChIKey of 1H-pyrrolo[3,4-d]pyrazole-4,6-dione?
The InChIKey is CPPSELCSKOZONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3O2/c9-4-2-1-6-8-3(2)5(10)7-4/h1H,(H,6,8)(H,7,9,10).
What are the key properties of 1H-pyrrolo[3,4-d]pyrazole-4,6-dione?
1H-pyrrolo[3,4-d]pyrazole-4,6-dione has a molecular weight of 137.10 g/mol, XLogP of -0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,4-d]pyrazole-4,6-dione is sourced from PubChem (CID 19102688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).