C14H13N3 — CID 19102700
8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaene (PubChem CID 19102700) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaene.
| Compound Name | 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaene |
|---|---|
| PubChem CID | 19102700 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaene |
| SMILES | c1ccc2c(c1)ncc1c3c([nH]c12)CCNC3 |
| InChI | InChI=1S/C14H13N3/c1-2-4-12-9(3-1)14-11(8-16-12)10-7-15-6-5-13(10)17-14/h1-4,8,15,17H,5-7H2 |
| InChIKey | SNLHHLFCWATVJP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |