C21H16ClN3O — CID 19102708
(5-chloro-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)-phenylmethanone (PubChem CID 19102708) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is (5-chloro-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)-phenylmethanone.
| Compound Name | (5-chloro-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)-phenylmethanone |
|---|---|
| PubChem CID | 19102708 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (5-chloro-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-13-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCc2[nH]c3c(cnc4cc(Cl)ccc43)c2C1 |
| InChI | InChI=1S/C21H16ClN3O/c22-14-6-7-15-19(10-14)23-11-16-17-12-25(9-8-18(17)24-20(15)16)21(26)13-4-2-1-3-5-13/h1-7,10-11,24H,8-9,12H2 |
| InChIKey | PJLJIXAFZZCMTA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |