About 5-nitrosoquinolin-8-ol
5-nitrosoquinolin-8-ol (PubChem CID 19103) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 5-nitrosoquinolin-8-ol.
Molecular Properties
| Compound Name | 5-nitrosoquinolin-8-ol |
| PubChem CID | 19103 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-nitrosoquinolin-8-ol |
| SMILES | O=Nc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C9H6N2O2/c12-8-4-3-7(11-13)6-2-1-5-10-9(6)8/h1-5,12H |
| InChIKey | RZWRYPGAUIOOMK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-nitrosoquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrosoquinolin-8-ol?
The IUPAC name of 5-nitrosoquinolin-8-ol (CID 19103) is 5-nitrosoquinolin-8-ol.
What is the SMILES notation for 5-nitrosoquinolin-8-ol?
The canonical SMILES for 5-nitrosoquinolin-8-ol is O=Nc1ccc(O)c2ncccc12.
What is the InChIKey of 5-nitrosoquinolin-8-ol?
The InChIKey is RZWRYPGAUIOOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-8-4-3-7(11-13)6-2-1-5-10-9(6)8/h1-5,12H.
What are the key properties of 5-nitrosoquinolin-8-ol?
5-nitrosoquinolin-8-ol has a molecular weight of 174.16 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrosoquinolin-8-ol is sourced from PubChem (CID 19103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).