C26H33N3O5 — CID 19103151
5-[(3,5-ditert-butyl-4-hydroxyanilino)-(pyridin-3-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 19103151) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-4-hydroxyanilino)-(pyridin-3-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3,5-ditert-butyl-4-hydroxyanilino)-(pyridin-3-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 19103151 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 5-[(3,5-ditert-butyl-4-hydroxyanilino)-(pyridin-3-ylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C(Nc2cccnc2)Nc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)O1 |
| InChI | InChI=1S/C26H33N3O5/c1-24(2,3)17-12-16(13-18(20(17)30)25(4,5)6)29-21(28-15-10-9-11-27-14-15)19-22(31)33-26(7,8)34-23(19)32/h9-14,28-30H,1-8H3 |
| InChIKey | CWKYQSBUOBFIKT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|