About 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole
5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole (PubChem CID 19103181) has the molecular formula C12H6ClF6N
and a molecular weight of 313.63 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole |
| PubChem CID | 19103181 |
| Molecular Formula | C12H6ClF6N |
| Molecular Weight | 313.63 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole |
| SMILES | FC(F)(F)c1cc(-c2ccc(Cl)cc2)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C12H6ClF6N/c13-7-3-1-6(2-4-7)9-5-8(11(14,15)16)10(20-9)12(17,18)19/h1-5,20H |
| InChIKey | GCZALKJOOCILPK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole?
The IUPAC name of 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole (CID 19103181) is 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole.
What is the SMILES notation for 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole?
The canonical SMILES for 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole is FC(F)(F)c1cc(-c2ccc(Cl)cc2)[nH]c1C(F)(F)F.
What is the InChIKey of 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole?
The InChIKey is GCZALKJOOCILPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6ClF6N/c13-7-3-1-6(2-4-7)9-5-8(11(14,15)16)10(20-9)12(17,18)19/h1-5,20H.
What are the key properties of 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole?
5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole has a molecular weight of 313.63 g/mol, XLogP of 5.37, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,3-bis(trifluoromethyl)-1H-pyrrole is sourced from PubChem (CID 19103181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).