C20H30F2 — CID 19103585
2,3-difluoro-1-pentyl-4-(4-propylcyclohexyl)benzene (PubChem CID 19103585) has the molecular formula C20H30F2 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2,3-difluoro-1-pentyl-4-(4-propylcyclohexyl)benzene.
| Compound Name | 2,3-difluoro-1-pentyl-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 19103585 |
| Molecular Formula | C20H30F2 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2,3-difluoro-1-pentyl-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCCCc1ccc(C2CCC(CCC)CC2)c(F)c1F |
| InChI | InChI=1S/C20H30F2/c1-3-5-6-8-17-13-14-18(20(22)19(17)21)16-11-9-15(7-4-2)10-12-16/h13-16H,3-12H2,1-2H3 |
| InChIKey | NDRXETWNWAVFFY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|