C27H30F2N2O2 — CID 19103780
[4-(5-heptylpyrimidin-2-yl)phenyl] 2,3-difluoro-4-propylbenzoate (PubChem CID 19103780) has the molecular formula C27H30F2N2O2 and a molecular weight of 452.55 g/mol. Its IUPAC name is [4-(5-heptylpyrimidin-2-yl)phenyl] 2,3-difluoro-4-propylbenzoate.
| Compound Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 2,3-difluoro-4-propylbenzoate |
|---|---|
| PubChem CID | 19103780 |
| Molecular Formula | C27H30F2N2O2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [4-(5-heptylpyrimidin-2-yl)phenyl] 2,3-difluoro-4-propylbenzoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(OC(=O)c3ccc(CCC)c(F)c3F)cc2)nc1 |
| InChI | InChI=1S/C27H30F2N2O2/c1-3-5-6-7-8-10-19-17-30-26(31-18-19)21-11-14-22(15-12-21)33-27(32)23-16-13-20(9-4-2)24(28)25(23)29/h11-18H,3-10H2,1-2H3 |
| InChIKey | MWSKWVMWZZSUEN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|