C8H8N2 — CID 19103929
6,8a-dihydro-1,6-naphthyridine (PubChem CID 19103929) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 6,8a-dihydro-1,6-naphthyridine.
| Compound Name | 6,8a-dihydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 19103929 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 6,8a-dihydro-1,6-naphthyridine |
| SMILES | C1=CC2=CNC=CC2N=C1 |
| InChI | InChI=1S/C8H8N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1-6,8-9H |
| InChIKey | BOVXKWHBHOSXLL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |