About CID 19104363
CID 19104363 (PubChem CID 19104363) has the molecular formula C4H5BNO2S
and a molecular weight of 141.97 g/mol.
Molecular Properties
| Compound Name | CID 19104363 |
| PubChem CID | 19104363 |
| Molecular Formula | C4H5BNO2S |
| Molecular Weight | 141.97 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | — |
| SMILES | O=C(O)[B]N1C=CSC1 |
| InChI | InChI=1S/C4H5BNO2S/c7-4(8)5-6-1-2-9-3-6/h1-2H,3H2,(H,7,8) |
| InChIKey | UWINNLNXZSARKC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.97 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19104363 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19104363?
The IUPAC name of CID 19104363 (CID 19104363) is not available.
What is the SMILES notation for CID 19104363?
The canonical SMILES for CID 19104363 is O=C(O)[B]N1C=CSC1.
What is the InChIKey of CID 19104363?
The InChIKey is UWINNLNXZSARKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BNO2S/c7-4(8)5-6-1-2-9-3-6/h1-2H,3H2,(H,7,8).
What are the key properties of CID 19104363?
CID 19104363 has a molecular weight of 141.97 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19104363 is sourced from PubChem (CID 19104363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).