C12H17N3O12 — CID 19104541
3-[1,4-dihydroxy-3-(hydroxymethyl)butan-2-yl]-1,5-dinitro-3-(2-nitroacetyl)pentane-2,4-dione (PubChem CID 19104541) has the molecular formula C12H17N3O12 and a molecular weight of 395.28 g/mol. Its IUPAC name is 3-[1,4-dihydroxy-3-(hydroxymethyl)butan-2-yl]-1,5-dinitro-3-(2-nitroacetyl)pentane-2,4-dione.
| Compound Name | 3-[1,4-dihydroxy-3-(hydroxymethyl)butan-2-yl]-1,5-dinitro-3-(2-nitroacetyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 19104541 |
| Molecular Formula | C12H17N3O12 |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-[1,4-dihydroxy-3-(hydroxymethyl)butan-2-yl]-1,5-dinitro-3-(2-nitroacetyl)pentane-2,4-dione |
| SMILES | O=C(C[N+](=O)[O-])C(C(=O)C[N+](=O)[O-])(C(=O)C[N+](=O)[O-])C(CO)C(CO)CO |
| InChI | InChI=1S/C12H17N3O12/c16-4-7(5-17)8(6-18)12(9(19)1-13(22)23,10(20)2-14(24)25)11(21)3-15(26)27/h7-8,16-18H,1-6H2 |
| InChIKey | MDLYSEPDUBWFEL-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 241.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|