About 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid
6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid (PubChem CID 19105284) has the molecular formula C24H25ClO5
and a molecular weight of 428.91 g/mol. Its IUPAC name is 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid |
| PubChem CID | 19105284 |
| Molecular Formula | C24H25ClO5 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid |
| SMILES | CC(C)(C)c1cc(-c2c(C(=O)O)c(=O)oc3ccc(Cl)cc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H25ClO5/c1-23(2,3)15-9-12(10-16(20(15)26)24(4,5)6)18-14-11-13(25)7-8-17(14)30-22(29)19(18)21(27)28/h7-11,26H,1-6H3,(H,27,28) |
| InChIKey | OPBYXJNRDMAGLR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid?
The IUPAC name of 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid (CID 19105284) is 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid.
What is the SMILES notation for 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid?
The canonical SMILES for 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid is CC(C)(C)c1cc(-c2c(C(=O)O)c(=O)oc3ccc(Cl)cc23)cc(C(C)(C)C)c1O.
What is the InChIKey of 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid?
The InChIKey is OPBYXJNRDMAGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25ClO5/c1-23(2,3)15-9-12(10-16(20(15)26)24(4,5)6)18-14-11-13(25)7-8-17(14)30-22(29)19(18)21(27)28/h7-11,26H,1-6H3,(H,27,28).
What are the key properties of 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid?
6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid has a molecular weight of 428.91 g/mol, XLogP of 6.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxochromene-3-carboxylic acid is sourced from PubChem (CID 19105284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).