About 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane
4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane (PubChem CID 19106312) has the molecular formula C10H23N5O
and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane.
Molecular Properties
| Compound Name | 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane |
| PubChem CID | 19106312 |
| Molecular Formula | C10H23N5O |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane |
| SMILES | CCCC(C)C.CN(C)c1n[nH]c(=O)n1N |
| InChI | InChI=1S/C6H14.C4H9N5O/c1-4-5-6(2)3;1-8(2)3-6-7-4(10)9(3)5/h6H,4-5H2,1-3H3;5H2,1-2H3,(H,7,10) |
| InChIKey | NTMXYFPZVMVGBQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane?
The IUPAC name of 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane (CID 19106312) is 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane.
What is the SMILES notation for 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane?
The canonical SMILES for 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane is CCCC(C)C.CN(C)c1n[nH]c(=O)n1N.
What is the InChIKey of 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane?
The InChIKey is NTMXYFPZVMVGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C4H9N5O/c1-4-5-6(2)3;1-8(2)3-6-7-4(10)9(3)5/h6H,4-5H2,1-3H3;5H2,1-2H3,(H,7,10).
What are the key properties of 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane?
4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane has a molecular weight of 229.33 g/mol, XLogP of 0.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(dimethylamino)-1H-1,2,4-triazol-5-one;2-methylpentane is sourced from PubChem (CID 19106312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).