C17H15FO — CID 19106438
2-ethynyl-1-[(4-fluorophenyl)methoxy]-3,5-dimethylbenzene (PubChem CID 19106438) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-ethynyl-1-[(4-fluorophenyl)methoxy]-3,5-dimethylbenzene.
| Compound Name | 2-ethynyl-1-[(4-fluorophenyl)methoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 19106438 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-ethynyl-1-[(4-fluorophenyl)methoxy]-3,5-dimethylbenzene |
| SMILES | C#Cc1c(C)cc(C)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FO/c1-4-16-13(3)9-12(2)10-17(16)19-11-14-5-7-15(18)8-6-14/h1,5-10H,11H2,2-3H3 |
| InChIKey | PVGSWYRZTZGGJW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|