C11H9Cl3N2O3S — CID 19106533
5-[3-methoxy-5-(trichloromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 19106533) has the molecular formula C11H9Cl3N2O3S and a molecular weight of 355.63 g/mol. Its IUPAC name is 5-[3-methoxy-5-(trichloromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 5-[3-methoxy-5-(trichloromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 19106533 |
| Molecular Formula | C11H9Cl3N2O3S |
| Molecular Weight | 355.63 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 5-[3-methoxy-5-(trichloromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | COc1cc(OC(Cl)(Cl)Cl)cc(C2=NNC(=O)SC2)c1 |
| InChI | InChI=1S/C11H9Cl3N2O3S/c1-18-7-2-6(9-5-20-10(17)16-15-9)3-8(4-7)19-11(12,13)14/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | ZGDYKHJNPTXZKS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|