C12H9Cl5N2O3S — CID 19106536
5-[3-methoxy-4-(1,1,2,2,2-pentachloroethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 19106536) has the molecular formula C12H9Cl5N2O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 5-[3-methoxy-4-(1,1,2,2,2-pentachloroethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 5-[3-methoxy-4-(1,1,2,2,2-pentachloroethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 19106536 |
| Molecular Formula | C12H9Cl5N2O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 435.88 |
| IUPAC Name | 5-[3-methoxy-4-(1,1,2,2,2-pentachloroethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | COc1cc(C2=NNC(=O)SC2)ccc1OC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H9Cl5N2O3S/c1-21-9-4-6(7-5-23-10(20)19-18-7)2-3-8(9)22-12(16,17)11(13,14)15/h2-4H,5H2,1H3,(H,19,20) |
| InChIKey | WAQOVEOJJOTSGJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|