C23H30F2N2O3 — CID 19106735
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(2,2-dimethoxyethyl)piperazine (PubChem CID 19106735) has the molecular formula C23H30F2N2O3 and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(2,2-dimethoxyethyl)piperazine.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(2,2-dimethoxyethyl)piperazine |
|---|---|
| PubChem CID | 19106735 |
| Molecular Formula | C23H30F2N2O3 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(2,2-dimethoxyethyl)piperazine |
| SMILES | COC(CN1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)OC |
| InChI | InChI=1S/C23H30F2N2O3/c1-28-22(29-2)17-27-13-11-26(12-14-27)15-16-30-23(18-3-7-20(24)8-4-18)19-5-9-21(25)10-6-19/h3-10,22-23H,11-17H2,1-2H3 |
| InChIKey | DUVFUTGNSPUNGO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|