C25H25FO3S — CID 19106750
4-[3-[4-[(4-fluorophenoxy)methyl]phenyl]sulfanylphenyl]-4-methoxyoxane (PubChem CID 19106750) has the molecular formula C25H25FO3S and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[3-[4-[(4-fluorophenoxy)methyl]phenyl]sulfanylphenyl]-4-methoxyoxane.
| Compound Name | 4-[3-[4-[(4-fluorophenoxy)methyl]phenyl]sulfanylphenyl]-4-methoxyoxane |
|---|---|
| PubChem CID | 19106750 |
| Molecular Formula | C25H25FO3S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-[3-[4-[(4-fluorophenoxy)methyl]phenyl]sulfanylphenyl]-4-methoxyoxane |
| SMILES | COC1(c2cccc(Sc3ccc(COc4ccc(F)cc4)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C25H25FO3S/c1-27-25(13-15-28-16-14-25)20-3-2-4-24(17-20)30-23-11-5-19(6-12-23)18-29-22-9-7-21(26)8-10-22/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | OVGQJYQLAZYIPF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |