C14H19NO — CID 19106956
N-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine (PubChem CID 19106956) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine.
| Compound Name | N-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine |
|---|---|
| PubChem CID | 19106956 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-methyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine |
| SMILES | CNC12CCCCC1COc1ccccc12 |
| InChI | InChI=1S/C14H19NO/c1-15-14-9-5-4-6-11(14)10-16-13-8-3-2-7-12(13)14/h2-3,7-8,11,15H,4-6,9-10H2,1H3 |
| InChIKey | FAQSNJSRAOMLFA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |