C14H17NO — CID 19106988
4b-amino-8,8a,9,10-tetrahydro-5H-phenanthren-3-ol (PubChem CID 19106988) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 4b-amino-8,8a,9,10-tetrahydro-5H-phenanthren-3-ol.
| Compound Name | 4b-amino-8,8a,9,10-tetrahydro-5H-phenanthren-3-ol |
|---|---|
| PubChem CID | 19106988 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4b-amino-8,8a,9,10-tetrahydro-5H-phenanthren-3-ol |
| SMILES | NC12CC=CCC1CCc1ccc(O)cc12 |
| InChI | InChI=1S/C14H17NO/c15-14-8-2-1-3-11(14)6-4-10-5-7-12(16)9-13(10)14/h1-2,5,7,9,11,16H,3-4,6,8,15H2 |
| InChIKey | RCQVOQLTSIQULP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|