C14H19NO — CID 19107031
4b-amino-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-ol (PubChem CID 19107031) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4b-amino-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-ol.
| Compound Name | 4b-amino-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-ol |
|---|---|
| PubChem CID | 19107031 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4b-amino-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-ol |
| SMILES | NC12CCCCC1CCc1ccc(O)cc12 |
| InChI | InChI=1S/C14H19NO/c15-14-8-2-1-3-11(14)6-4-10-5-7-12(16)9-13(10)14/h5,7,9,11,16H,1-4,6,8,15H2 |
| InChIKey | BVENLBFYZBQGMM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |