C14H17NS — CID 19107039
N-methyl-6,6a,7,10-tetrahydrobenzo[c]thiochromen-10a-amine (PubChem CID 19107039) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is N-methyl-6,6a,7,10-tetrahydrobenzo[c]thiochromen-10a-amine.
| Compound Name | N-methyl-6,6a,7,10-tetrahydrobenzo[c]thiochromen-10a-amine |
|---|---|
| PubChem CID | 19107039 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-methyl-6,6a,7,10-tetrahydrobenzo[c]thiochromen-10a-amine |
| SMILES | CNC12CC=CCC1CSc1ccccc12 |
| InChI | InChI=1S/C14H17NS/c1-15-14-9-5-4-6-11(14)10-16-13-8-3-2-7-12(13)14/h2-5,7-8,11,15H,6,9-10H2,1H3 |
| InChIKey | RWUGKZBKPGNVKR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|