C14H19N — CID 19107042
6,7,8,9,9a,10-hexahydro-5H-benzo[a]azulen-4b-amine (PubChem CID 19107042) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 6,7,8,9,9a,10-hexahydro-5H-benzo[a]azulen-4b-amine.
| Compound Name | 6,7,8,9,9a,10-hexahydro-5H-benzo[a]azulen-4b-amine |
|---|---|
| PubChem CID | 19107042 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 6,7,8,9,9a,10-hexahydro-5H-benzo[a]azulen-4b-amine |
| SMILES | NC12CCCCCC1Cc1ccccc12 |
| InChI | InChI=1S/C14H19N/c15-14-9-5-1-2-7-12(14)10-11-6-3-4-8-13(11)14/h3-4,6,8,12H,1-2,5,7,9-10,15H2 |
| InChIKey | FBPLUINZXYUXPM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |