About 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate
2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate (PubChem CID 19107499) has the molecular formula C6H8F3NO2
and a molecular weight of 183.13 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate |
| PubChem CID | 19107499 |
| Molecular Formula | C6H8F3NO2 |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C6H8F3NO2/c1-4(10)2-5(11)12-3-6(7,8)9/h2H,3,10H2,1H3/b4-2- |
| InChIKey | FTWVSFKTRVFPLU-RQOWECAXSA-N |
| XLogP | 0.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate?
The IUPAC name of 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate (CID 19107499) is 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate.
What is the SMILES notation for 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate?
The canonical SMILES for 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate is C/C(N)=C/C(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate?
The InChIKey is FTWVSFKTRVFPLU-RQOWECAXSA-N. The full InChI is InChI=1S/C6H8F3NO2/c1-4(10)2-5(11)12-3-6(7,8)9/h2H,3,10H2,1H3/b4-2-.
What are the key properties of 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate?
2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate has a molecular weight of 183.13 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl (Z)-3-aminobut-2-enoate is sourced from PubChem (CID 19107499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).