C10H16O2 — CID 19107719
(3E,5E)-2,6-dimethylocta-1,3,5-triene-1,1-diol (PubChem CID 19107719) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E,5E)-2,6-dimethylocta-1,3,5-triene-1,1-diol.
| Compound Name | (3E,5E)-2,6-dimethylocta-1,3,5-triene-1,1-diol |
|---|---|
| PubChem CID | 19107719 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3E,5E)-2,6-dimethylocta-1,3,5-triene-1,1-diol |
| SMILES | CC/C(C)=C/C=C/C(C)=C(O)O |
| InChI | InChI=1S/C10H16O2/c1-4-8(2)6-5-7-9(3)10(11)12/h5-7,11-12H,4H2,1-3H3/b7-5+,8-6+ |
| InChIKey | UXBJENSVKCCCSH-KQQUZDAGSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|