About (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate
(5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate (PubChem CID 19107834) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate.
Molecular Properties
| Compound Name | (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate |
| PubChem CID | 19107834 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate |
| SMILES | CCCCC(=O)OC1C=CC(OC(=O)CCCC)O1 |
| InChI | InChI=1S/C14H22O5/c1-3-5-7-11(15)17-13-9-10-14(19-13)18-12(16)8-6-4-2/h9-10,13-14H,3-8H2,1-2H3 |
| InChIKey | SWHJJVDSQJOMKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate?
The IUPAC name of (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate (CID 19107834) is (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate.
What is the SMILES notation for (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate?
The canonical SMILES for (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate is CCCCC(=O)OC1C=CC(OC(=O)CCCC)O1.
What is the InChIKey of (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate?
The InChIKey is SWHJJVDSQJOMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5/c1-3-5-7-11(15)17-13-9-10-14(19-13)18-12(16)8-6-4-2/h9-10,13-14H,3-8H2,1-2H3.
What are the key properties of (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate?
(5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate has a molecular weight of 270.32 g/mol, XLogP of 2.69, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-pentanoyloxy-2,5-dihydrofuran-2-yl) pentanoate is sourced from PubChem (CID 19107834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).