C17H20N4O7 — CID 19108184
2-(2,5-dioxopyrrol-1-yl)-N-[3-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-hydroxypropyl]propanamide (PubChem CID 19108184) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-[3-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-hydroxypropyl]propanamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-[3-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-hydroxypropyl]propanamide |
|---|---|
| PubChem CID | 19108184 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-[3-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-hydroxypropyl]propanamide |
| SMILES | CC(C(=O)NCC(O)CNC(=O)C(C)N1C(=O)C=CC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H20N4O7/c1-9(20-12(23)3-4-13(20)24)16(27)18-7-11(22)8-19-17(28)10(2)21-14(25)5-6-15(21)26/h3-6,9-11,22H,7-8H2,1-2H3,(H,18,27)(H,19,28) |
| InChIKey | QBSQAOPONHBZJK-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|