About 2-pyrazol-1-ylguanidine
2-pyrazol-1-ylguanidine (PubChem CID 19108548) has the molecular formula C4H7N5
and a molecular weight of 125.13 g/mol. Its IUPAC name is 2-pyrazol-1-ylguanidine.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylguanidine |
| PubChem CID | 19108548 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 2-pyrazol-1-ylguanidine |
| SMILES | NC(N)=Nn1cccn1 |
| InChI | InChI=1S/C4H7N5/c5-4(6)8-9-3-1-2-7-9/h1-3H,(H4,5,6,8) |
| InChIKey | SNBIKXUTMUAKCJ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrazol-1-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylguanidine?
The IUPAC name of 2-pyrazol-1-ylguanidine (CID 19108548) is 2-pyrazol-1-ylguanidine.
What is the SMILES notation for 2-pyrazol-1-ylguanidine?
The canonical SMILES for 2-pyrazol-1-ylguanidine is NC(N)=Nn1cccn1.
What is the InChIKey of 2-pyrazol-1-ylguanidine?
The InChIKey is SNBIKXUTMUAKCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5/c5-4(6)8-9-3-1-2-7-9/h1-3H,(H4,5,6,8).
What are the key properties of 2-pyrazol-1-ylguanidine?
2-pyrazol-1-ylguanidine has a molecular weight of 125.13 g/mol, XLogP of -1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylguanidine is sourced from PubChem (CID 19108548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).