C14H20BiN7O9S3 — CID 19108549
bismuth;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 19108549) has the molecular formula C14H20BiN7O9S3 and a molecular weight of 735.53 g/mol. Its IUPAC name is bismuth;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | bismuth;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 19108549 |
| Molecular Formula | C14H20BiN7O9S3 |
| Molecular Weight | 735.53 g/mol |
| Exact Mass | 735.03 |
| IUPAC Name | bismuth;3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-sulfamoylpropanimidamide;2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | NC(N)=Nc1nc(CSCC/C(N)=N\S(N)(=O)=O)cs1.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Bi+3] |
| InChI | InChI=1S/C8H15N7O2S3.C6H8O7.Bi/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11;7-3(8)1-6(13,5(11)12)2-4(9)10;/h4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+3/p-3 |
| InChIKey | KUEVYTAGCXZLPU-UHFFFAOYSA-K |
| XLogP | -6.40 |
| TPSA | 316.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.53 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|