About 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid
5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 19108615) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 19108615 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | CC(=O)NCC1CC(C(=O)O)=NO1 |
| InChI | InChI=1S/C7H10N2O4/c1-4(10)8-3-5-2-6(7(11)12)9-13-5/h5H,2-3H2,1H3,(H,8,10)(H,11,12) |
| InChIKey | PADHGBAAQAIIEQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CID 19108615) is 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid is CC(=O)NCC1CC(C(=O)O)=NO1.
What is the InChIKey of 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
The InChIKey is PADHGBAAQAIIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-4(10)8-3-5-2-6(7(11)12)9-13-5/h5H,2-3H2,1H3,(H,8,10)(H,11,12).
What are the key properties of 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid?
5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid has a molecular weight of 186.17 g/mol, XLogP of -0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(acetamidomethyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 19108615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).