About 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride
2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride (PubChem CID 19108616) has the molecular formula C6H11ClN2O2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride |
| PubChem CID | 19108616 |
| Molecular Formula | C6H11ClN2O2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride |
| SMILES | Cl.NCc1cc(CCO)no1 |
| InChI | InChI=1S/C6H10N2O2.ClH/c7-4-6-3-5(1-2-9)8-10-6;/h3,9H,1-2,4,7H2;1H |
| InChIKey | VMCFSBXBSRFISK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride?
The IUPAC name of 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride (CID 19108616) is 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride.
What is the SMILES notation for 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride?
The canonical SMILES for 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride is Cl.NCc1cc(CCO)no1.
What is the InChIKey of 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride?
The InChIKey is VMCFSBXBSRFISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.ClH/c7-4-6-3-5(1-2-9)8-10-6;/h3,9H,1-2,4,7H2;1H.
What are the key properties of 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride?
2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride has a molecular weight of 178.62 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(aminomethyl)-1,2-oxazol-3-yl]ethanol;hydrochloride is sourced from PubChem (CID 19108616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).