C30H37NO6 — CID 19108997
1-(3-ethoxy-4-propoxyphenyl)-6,8-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19108997) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-(3-ethoxy-4-propoxyphenyl)-6,8-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-ethoxy-4-propoxyphenyl)-6,8-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19108997 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 1-(3-ethoxy-4-propoxyphenyl)-6,8-dimethyl-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCOc1ccc(C2c3c(oc4cc(C)cc(C)c4c3=O)C(=O)N2CCCOC(C)C)cc1OCC |
| InChI | InChI=1S/C30H37NO6/c1-7-13-36-22-11-10-21(17-23(22)34-8-2)27-26-28(32)25-20(6)15-19(5)16-24(25)37-29(26)30(33)31(27)12-9-14-35-18(3)4/h10-11,15-18,27H,7-9,12-14H2,1-6H3 |
| InChIKey | VWRJRCAFDQQTOM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|