C23H28N2O4 — CID 19110472
(5E)-1-butan-2-yl-5-[(3-ethoxy-4-propoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110472) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (5E)-1-butan-2-yl-5-[(3-ethoxy-4-propoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-butan-2-yl-5-[(3-ethoxy-4-propoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110472 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (5E)-1-butan-2-yl-5-[(3-ethoxy-4-propoxyphenyl)methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(/C=C2/C(=O)N(C(C)CC)C(=O)C(C#N)=C2C)cc1OCC |
| InChI | InChI=1S/C23H28N2O4/c1-6-11-29-20-10-9-17(13-21(20)28-8-3)12-18-16(5)19(14-24)23(27)25(22(18)26)15(4)7-2/h9-10,12-13,15H,6-8,11H2,1-5H3/b18-12+ |
| InChIKey | ZSRTXLGUEZITPH-LDADJPATSA-N |
| XLogP | 4.26 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|